Munurin millum rættingarnar hjá "Chloramphenicol"

2.016 bytes løgd afturat ,  5 ár síðan
ongin frágreiðing um rættingina
s (Bot: Migrating 29 interwiki links, now provided by Wikidata on d:q274515 (translate me))
 
{{Drugbox
[[Mynd:Chloramphenicol-2D-skeletal.png|thumb|Samansetingin av Chloramphenicol.]]
| Watchedfields = changed
| verifiedrevid = 443513464
| drug_name = Chloramphenicol (<small>[[International Nonproprietary Name|INN]]</small>)
| IUPAC_name = 2,2-dichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide
| image = Chloramphenicol-2D-skeletal.svg
| image2 = Chloramphenicol-3D-vdW.png
 
<!--Clinical data-->
| tradename = Pentamycetin, Chloromycetin<ref name=Wood2009/>
| Drugs.com = {{drugs.com|monograph|chloramphenicol}}
| MedlinePlus = a608008
| licence_US = Chloramphenicol
| pregnancy_AU = A
| pregnancy_US = C
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Lokalt (eygnadropar), við, IV, IM
 
<!--Pharmacokinetic data-->
| bioavailability = 75–90%
| protein_bound = 60%
| metabolism = [[Livur]]
| elimination_half-life = 1.6-3.3 hours
| excretion = Nýru (5-15%), skarn (4%)
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 56-75-7
| ATC_prefix = D06
| ATC_suffix = AX02
| ATC_supplemental = {{ATC|D10|AF03}} {{ATC|G01|AA05}} {{ATC|J01|BA01}} {{ATC|S01|AA01}} {{ATC|S02|AA01}} {{ATC|S03|AA08}} {{ATCvet|J51|BA01}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17698
| PubChem = 298
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00446
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5744
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 66974FR9Q1
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00104
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 130
 
<!--Chemical data-->
| C=11 | H=12 | Cl=2 | N=2 | O=5
| molecular_weight = 323.1320 g/mol
| smiles = c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]
| InChI = 1/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WIIZWVCIJKGZOK-RKDXNWHRSA-N
}}
 
'''Chloramphenicol''' er eitt slag av [[antibiotika]]. Tað virkar við at binda til bakteriu [[ribosom]]ið og forða fyri [[ensym]]inum [[peptidyl transferase]]. Tað hevur tann fyrimunin eisini at ávirka ([[eukaryot]]ar) menniskjakyknur og kann tí nýtast ímóti bakterium, ið goyma seg inni í menniskjakyknum. Tað verður tó sjáldan nýtt longur í framkomnum londum, vegna sjáldsama, men álvarsliga hjáárinið blóðmangul.